CymitQuimica logo

CAS 916258-24-7

:

2-Methyl-2-propanyl 5-bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-carboxylate

Description:
2-Methyl-2-propanyl 5-bromo-3-methyl-1H-pyrazolo[3,4-b]pyridine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a pyrazolo[3,4-b]pyridine core, a carboxylate functional group, and a bromine substituent. This compound features a branched alkyl group (2-methyl-2-propanyl) that contributes to its lipophilicity, potentially influencing its solubility and biological activity. The presence of the bromine atom may enhance its reactivity and provide opportunities for further chemical modifications. Pyrazolo[3,4-b]pyridine derivatives are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The compound's molecular structure suggests it may exhibit specific interactions with biological targets, making it of interest in drug discovery and development. Additionally, its unique combination of functional groups may impart distinctive physical and chemical properties, such as melting point, boiling point, and spectral characteristics, which are essential for its identification and characterization in laboratory settings.
Formula:C12H14BrN3O2
InChI:InChI=1S/C12H14BrN3O2/c1-7-9-5-8(13)6-14-10(9)16(15-7)11(17)18-12(2,3)4/h5-6H,1-4H3
InChI key:ZVHYMSMKXHSFLB-UHFFFAOYSA-N
SMILES:Cc1c2cc(cnc2n(C(=O)OC(C)(C)C)n1)Br
Synonyms:
  • 1H-Pyrazolo[3,4-b]pyridine-1-carboxylic acid, 5-bromo-3-methyl-, 1,1-dimethylethyl ester
Found 4 products.