CAS 916326-31-3
:1H-Pyrazolo[3,4-b]pyridine-1-carboxylic acid, 5-broMo-3-iodo-, 1,1-diMethylethyl ester
Description:
1H-Pyrazolo[3,4-b]pyridine-1-carboxylic acid, 5-bromo-3-iodo-, 1,1-dimethylethyl ester is a chemical compound characterized by its complex heterocyclic structure, which includes a pyrazolo-pyridine framework. This compound features a carboxylic acid derivative, where the carboxylic acid group is esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The presence of bromine and iodine substituents at specific positions on the aromatic ring contributes to its reactivity and may affect its pharmacological properties. Such halogenated compounds are often of interest in medicinal chemistry due to their potential as bioactive agents. The compound's molecular structure suggests it may exhibit interesting interactions with biological targets, making it a candidate for further investigation in drug development. Additionally, its CAS number, 916326-31-3, allows for precise identification in chemical databases, facilitating research and application in various scientific fields.
Formula:C11H11BrIN3O2
InChI:InChI=1S/C11H11BrIN3O2/c1-11(2,3)18-10(17)16-9-7(8(13)15-16)4-6(12)5-14-9/h4-5H,1-3H3
InChI key:NXIOVBJEZOJTPW-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1C2=C(C=C(C=N2)Br)C(=N1)I
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
tert-Butyl 5-bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
CAS:Formula:C11H11BrIN3O2Molecular weight:424.0324tert-Butyl 5-bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
CAS:tert-Butyl 5-bromo-3-iodo-1H-pyrazolo[3,4-b]pyridine-1-carboxylate
Molecular weight:424.03g/mol

