CymitQuimica logo

CAS 916326-37-9

:

5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carbaldehyde

Description:
5-Bromo-1H-pyrazolo[3,4-b]pyridine-3-carbaldehyde is a heterocyclic organic compound characterized by its unique pyrazolo-pyridine structure, which incorporates both a pyrazole and a pyridine ring. The presence of a bromine atom at the 5-position and an aldehyde functional group at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF). Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of biologically active molecules. The compound's reactivity is influenced by the electron-withdrawing nature of the aldehyde group, which can participate in nucleophilic addition reactions. Additionally, the bromine substituent can serve as a site for further functionalization, enhancing its utility in drug discovery and development. Overall, 5-bromo-1H-pyrazolo[3,4-b]pyridine-3-carbaldehyde is a significant compound in the field of organic synthesis and pharmaceutical research.
Formula:C7H4BrN3O
InChI:InChI=1/C7H4BrN3O/c8-4-1-5-6(3-12)10-11-7(5)9-2-4/h1-3H,(H,9,10,11)
InChI key:WKKVMEWVAZFYPO-UHFFFAOYSA-N
SMILES:c1c(cnc2c1c(C=O)n[nH]2)Br
Synonyms:
  • 1H-pyrazolo[3,4-b]pyridine-3-carboxaldehyde, 5-bromo-
Found 4 products.