CymitQuimica logo

CAS 917023-06-4

:

methyl 2-(5-bromopyridin-2-yl)acetate

Description:
Methyl 2-(5-bromopyridin-2-yl)acetate is an organic compound characterized by its ester functional group and a pyridine ring substituted with a bromine atom. The presence of the bromine atom at the 5-position of the pyridine ring enhances its reactivity, making it useful in various chemical synthesis applications, particularly in medicinal chemistry and the development of pharmaceuticals. The methyl ester group contributes to its solubility in organic solvents, facilitating its use in reactions such as nucleophilic substitutions and coupling reactions. This compound typically exhibits moderate to high stability under standard conditions but may undergo hydrolysis in the presence of strong acids or bases. Its molecular structure allows for potential interactions with biological targets, making it a candidate for further investigation in drug discovery. Additionally, the compound's unique properties can be exploited in the synthesis of more complex molecules, showcasing its versatility in organic synthesis. Safety precautions should be observed when handling this compound due to the presence of bromine, which can be hazardous.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-12-8(11)4-7-3-2-6(9)5-10-7/h2-3,5H,4H2,1H3
InChI key:NIAATLPQSKGUBG-UHFFFAOYSA-N
SMILES:COC(=O)CC1=NC=C(C=C1)Br
Synonyms:
  • Methyl 5-Bromopyridine-2-Acetate
  • (5-Bromo-Pyridin-2-Yl)-Acetic Acid Methyl Ester
  • (5-Bromo-2-Pyridinyl)-Acetic Acid Methyl Ester
Found 4 products.