CAS 91732-68-2

1-Butan-2,2,3,3,4,4,4-d7-ol(9CI)

Description:

1-Butan-2,2,3,3,4,4,4-d7-ol, also known by its CAS number 91732-68-2, is a deuterated alcohol that serves as a valuable compound in various chemical and analytical applications. This substance features a butanol backbone with multiple deuterium substitutions, which enhances its utility in NMR spectroscopy and other isotopic labeling studies. The presence of deuterium, a stable isotope of hydrogen, allows for improved resolution and sensitivity in spectroscopic techniques. As an alcohol, it exhibits typical characteristics such as being a polar solvent, capable of forming hydrogen bonds, and having a relatively high boiling point compared to its non-deuterated counterparts. Its unique isotopic composition makes it particularly useful in research fields such as organic chemistry, biochemistry, and pharmacology, where tracking molecular interactions and reaction pathways is essential. Additionally, due to its structural features, it may also participate in various chemical reactions typical of alcohols, including oxidation and esterification.

Formula: C₄H₃D₇O

InChI: InChI=1S/C4H10O/c1-2-3-4-5/h5H,2-4H2,1H3/i1D3,2D2,3D2

InChI key: LRHPLDYGYMQRHN-NCKGIQLSSA-N

SMILES: [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])CO

Synonyms:

• N-Butyl-2,2,3,3,4,4,4-D7 Alcohol
• N-Butanol (2,2,3,3,4,4,4-D7)
• 1-Butanol-2,2,3,3,4,4,4-D7
• Butyl Alcohol (2,2,3,3,4,4,4-D7)

n-Butyl-2,2,3,3,4,4,4-d7Alcohol

Controlled Product

CAS: 71-36-3, 91732-68-2

Formula: CD₃CD₂CD₂CH₂OH

Purity: 98 atom % D

Color and Shape: Colorless Liquid

Molecular weight: 81.1171

Ref: 3U-D5537

n-Butyl-2,2,3,3,4,4,4-d7 Alcohol

Controlled Product

CAS: 91732-68-2

Formula: C₄D₇H₃O

Color and Shape: Neat

Molecular weight: 81.165

Ref: TR-B690056