CymitQuimica logo

CAS 917909-56-9

:

3-Thiophenecarboxylic acid, 2-amino-4-(trifluoromethyl)-, ethyl ester

Description:
3-Thiophenecarboxylic acid, 2-amino-4-(trifluoromethyl)-, ethyl ester is an organic compound characterized by its thiophene ring structure, which contributes to its aromatic properties. The presence of a carboxylic acid functional group indicates that it can participate in acid-base reactions, while the ethyl ester moiety suggests it can undergo esterification and hydrolysis. The amino group at the 2-position of the thiophene ring introduces basicity and potential for hydrogen bonding, enhancing its reactivity and solubility in polar solvents. The trifluoromethyl group at the 4-position significantly influences the compound's electronic properties, often increasing lipophilicity and altering its biological activity. This compound may exhibit interesting pharmacological properties due to its unique structural features, making it a candidate for various applications in medicinal chemistry. Overall, its combination of functional groups and heterocyclic structure provides a versatile platform for further chemical modifications and potential uses in drug development or agrochemicals.
Formula:C8H8F3NO2S
InChI:InChI=1S/C8H8F3NO2S/c1-2-14-7(13)5-4(8(9,10)11)3-15-6(5)12/h3H,2,12H2,1H3
InChI key:XXOJAIFAWOOYMV-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=C(SC=C1C(F)(F)F)N
Found 3 products.