CymitQuimica logo

CAS 917918-81-1

:

Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl-

Description:
Ethenamine, 2-(5-bromo-2-methoxy-3-nitro-4-pyridinyl)-N,N-dimethyl- is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with various functional groups. The presence of a bromine atom, a methoxy group, and a nitro group on the pyridine ring contributes to its unique reactivity and potential biological activity. The dimethylamino group attached to the ethenamine backbone enhances its nucleophilicity, making it a candidate for various chemical reactions. This compound may exhibit properties such as solubility in polar solvents, and its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific arrangement of substituents can influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. As with many compounds containing nitro and halogen substituents, it may also exhibit interesting electronic properties, which could be relevant in materials science or organic synthesis. Safety and handling precautions should be observed due to the presence of potentially hazardous functional groups.
Formula:C10H12BrN3O3
InChI:InChI=1S/C10H12BrN3O3/c1-13(2)5-4-7-8(11)6-12-10(17-3)9(7)14(15)16/h4-6H,1-3H3/b5-4+
InChI key:BNKMXMCVPWPRMR-SNAWJCMRSA-N
SMILES:CN(C)/C=C/C1=C(C(=NC=C1Br)OC)[N+](=O)[O-]
Found 3 products.