CymitQuimica logo

CAS 917918-82-2

:

Ethenamine, 2-(2,5-dimethoxy-3-nitro-4-pyridinyl)-N,N-dimethyl-

Description:
Ethenamine, 2-(2,5-dimethoxy-3-nitro-4-pyridinyl)-N,N-dimethyl- is a chemical compound characterized by its complex structure, which includes a pyridine ring substituted with methoxy and nitro groups. The presence of the ethenamine functional group indicates that it contains a double bond between carbon and nitrogen, contributing to its reactivity. The methoxy groups enhance its solubility in organic solvents and may influence its biological activity. The nitro group is known for its potential to participate in redox reactions, which can affect the compound's stability and reactivity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its CAS number, 917918-82-2, allows for precise identification in chemical databases. Overall, the characteristics of this compound suggest potential applications in various fields, including pharmaceuticals and materials science, although specific biological or chemical properties would require further investigation.
Formula:C11H15N3O4
InChI:InChI=1S/C11H15N3O4/c1-13(2)6-5-8-9(17-3)7-12-11(18-4)10(8)14(15)16/h5-7H,1-4H3/b6-5+
InChI key:RJNULHIDFOCAIN-AATRIKPKSA-N
SMILES:CN(C)/C=C/C1=C(C(=NC=C1OC)OC)[N+](=O)[O-]
Found 2 products.