CymitQuimica logo

CAS 917969-52-9

:

Pyridine, 4-bromo-2-hydrazinyl-3-iodo-

Description:
Pyridine, 4-bromo-2-hydrazinyl-3-iodo- is a heterocyclic organic compound characterized by its pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. The presence of bromine and iodine substituents at specific positions on the ring contributes to its reactivity and potential applications in various chemical reactions. The hydrazinyl group introduces a hydrazine functional moiety, which can participate in further chemical transformations, including coupling reactions and the formation of hydrazones. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential for interactions with biological targets, and its halogen substituents can influence its electronic properties and solubility. As with many halogenated compounds, it is essential to consider safety and environmental implications during handling and disposal. Overall, this compound represents a unique combination of functional groups that may be explored for various synthetic and pharmaceutical applications.
Formula:C5H5BrIN3
InChI:InChI=1S/C5H5BrIN3/c6-3-1-2-9-5(10-8)4(3)7/h1-2H,8H2,(H,9,10)
InChI key:ITTQYIFBRJKSLD-UHFFFAOYSA-N
SMILES:C1=CN=C(C(=C1Br)I)NN
Found 1 products.