CymitQuimica logo

CAS 918132-14-6

:

3,6,9,12-Tetraoxa-2-azatetradecanoic acid, 14-hydroxy-,1,1-dimethylethyl ester

Description:
3,6,9,12-Tetraoxa-2-azatetradecanoic acid, 14-hydroxy-, 1,1-dimethylethyl ester, identified by its CAS number 918132-14-6, is a complex organic compound characterized by its unique structure that includes multiple ether and amide functional groups. This compound features a long carbon chain, which contributes to its hydrophobic properties, while the presence of oxygen and nitrogen atoms introduces polar characteristics, making it amphiphilic. The ester functional group suggests that it can undergo hydrolysis, potentially releasing the corresponding acid and alcohol. Its hydroxyl group indicates the potential for hydrogen bonding, which can influence its solubility and reactivity in various solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Additionally, its structural features may allow it to interact with biological membranes or proteins, which could be relevant for drug delivery systems or as a surfactant. Overall, the compound's properties are dictated by its molecular structure, which combines hydrophilic and hydrophobic elements, influencing its behavior in different chemical environments.
Formula:C13H27NO7
InChI:InChI=1S/C13H27NO7/c1-13(2,3)21-12(16)14-20-11-10-19-9-8-18-7-6-17-5-4-15/h15H,4-11H2,1-3H3,(H,14,16)
InChI key:CHEZAYNNNOMTTB-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NOCCOCCOCCOCCO
Found 5 products.