CymitQuimica logo

CAS 918299-24-8

:

Cyclobutanone, 3-(2-bromophenyl)-

Description:
Cyclobutanone, 3-(2-bromophenyl)- is an organic compound characterized by its cyclobutanone structure, which features a four-membered carbon ring containing a ketone functional group. The presence of the 2-bromophenyl substituent introduces a bromine atom attached to a phenyl ring, influencing the compound's reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It may exhibit moderate solubility in organic solvents, while its solubility in water is generally low due to the hydrophobic nature of the aromatic ring. Cyclobutanones are known for their potential applications in organic synthesis and medicinal chemistry, often serving as intermediates in the production of various pharmaceuticals and agrochemicals. The bromine substituent can enhance electrophilic reactivity, making it a useful building block in further chemical transformations. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks if inhaled or ingested.
Formula:C10H9BrO
InChI:InChI=1S/C10H9BrO/c11-10-4-2-1-3-9(10)7-5-8(12)6-7/h1-4,7H,5-6H2
InChI key:BZFDEJVKRZVLKW-UHFFFAOYSA-N
SMILES:C1C(CC1=O)C2=CC=CC=C2Br
Found 1 products.