CAS 918344-20-4
:Benzeneacetonitrile, 4-hydroxy-a-(1-hydroxycyclohexyl)-
Description:
Benzeneacetonitrile, 4-hydroxy-α-(1-hydroxycyclohexyl)-, identified by its CAS number 918344-20-4, is a chemical compound characterized by its unique structure that includes a benzene ring, a nitrile group, and hydroxy substituents. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its reactivity and solubility. The presence of hydroxyl groups suggests potential for hydrogen bonding, which may enhance its solubility in polar solvents. Additionally, the nitrile group contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. The cyclohexyl moiety adds to the steric bulk and may affect the compound's overall stability and interaction with biological systems. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and spectral properties, would depend on the molecular environment and conditions under which the substance is studied. Overall, this compound may have applications in organic synthesis, pharmaceuticals, or as an intermediate in chemical manufacturing.
Formula:C14H17NO2
InChI:InChI=1S/C14H17NO2/c15-10-13(11-4-6-12(16)7-5-11)14(17)8-2-1-3-9-14/h4-7,13,16-17H,1-3,8-9H2
InChI key:HVHRRFPUUJSPLA-UHFFFAOYSA-N
SMILES:C1CCC(CC1)(C(C#N)C2=CC=C(C=C2)O)O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
2-(1-Hydroxycyclohexyl)-2-(4-hydroxyphenyl)acetonitrile
CAS:Formula:C14H17NO2Color and Shape:SolidMolecular weight:231.29034-Hydroxy-Alpha-(1-hydroxycyclohexyl)benzeneacetonitrile
CAS:Controlled ProductApplications Intermediate for the synthesis of O-desmethylvenlafaxine.
Formula:C14H17NO2Color and Shape:NeatMolecular weight:231.29


