CymitQuimica logo

CAS 918411-43-5

:

7-Azabicyclo[2.2.1]heptane-2,7-dicarboxylic acid, 7-(1,1-dimethylethyl)ester, (1R,2R,4S)-

Description:
7-Azabicyclo[2.2.1]heptane-2,7-dicarboxylic acid, 7-(1,1-dimethylethyl)ester, (1R,2R,4S)- is a bicyclic compound characterized by its unique azabicyclo structure, which incorporates a nitrogen atom into a seven-membered ring system. This compound features two carboxylic acid functional groups, which are esterified with a tert-butyl group, enhancing its lipophilicity and potentially influencing its biological activity. The stereochemistry indicated by (1R,2R,4S) suggests specific spatial arrangements of substituents around the chiral centers, which can significantly affect the compound's reactivity and interactions with biological targets. The presence of the bicyclic framework and the tert-butyl ester moiety may contribute to its stability and solubility properties. This compound may be of interest in medicinal chemistry and drug design due to its structural complexity and potential pharmacological applications. As with many chemical substances, safety data and handling precautions should be considered when working with this compound in a laboratory setting.
Formula:C12H19NO4
InChI:InChI=1S/C12H19NO4/c1-12(2,3)17-11(16)13-7-4-5-9(13)8(6-7)10(14)15/h7-9H,4-6H2,1-3H3,(H,14,15)/t7-,8+,9+/m0/s1
InChI key:XRDRXGVDCVQVPV-DJLDLDEBSA-N
SMILES:CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1[C@@H](C2)C(=O)O
Found 2 products.