CymitQuimica logo

CAS 918431-93-3

:

1,1-Dimethylethyl 4-cyano-4-fluoro-1-piperidinecarboxylate

Description:
1,1-Dimethylethyl 4-cyano-4-fluoro-1-piperidinecarboxylate, with the CAS number 918431-93-3, is a chemical compound characterized by its unique structural features. It contains a piperidine ring, which is a six-membered nitrogen-containing heterocycle, and is substituted with a cyano group (–C≡N) and a fluoro group (–F) at the 4-position. The presence of the tert-butyl group (1,1-dimethylethyl) enhances its steric bulk, potentially influencing its reactivity and interactions with biological targets. This compound is likely to exhibit properties typical of piperidine derivatives, such as potential pharmacological activity, making it of interest in medicinal chemistry. Its functional groups suggest it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Additionally, the cyano and fluoro substituents can impart unique electronic properties, affecting the compound's polarity and solubility. Overall, this compound's characteristics make it a subject of interest for further research in synthetic and medicinal chemistry applications.
Formula:C11H17FN2O2
InChI:InChI=1S/C11H17FN2O2/c1-10(2,3)16-9(15)14-6-4-11(12,8-13)5-7-14/h4-7H2,1-3H3
InChI key:InChIKey=AWCPTQNVIPVQQQ-UHFFFAOYSA-N
SMILES:C(#N)C1(F)CCN(C(OC(C)(C)C)=O)CC1
Synonyms:
  • 1,1-Dimethylethyl 4-cyano-4-fluoro-1-piperidinecarboxylate
  • 1-Piperidinecarboxylic acid, 4-cyano-4-fluoro-, 1,1-dimethylethyl ester
Found 3 products.