CymitQuimica logo

CAS 918487-39-5

:

3-Bromo-4-fluorophenylacetylene

Description:
3-Bromo-4-fluorophenylacetylene is an organic compound characterized by its unique structure, which includes a phenyl ring substituted with both bromine and fluorine atoms, as well as an acetylene functional group. The presence of these halogen substituents can influence the compound's reactivity and physical properties, such as solubility and boiling point. Typically, compounds like this exhibit moderate to high reactivity due to the presence of the triple bond in the acetylene group, making them useful in various synthetic applications, including organic synthesis and materials science. The bromine and fluorine atoms can also enhance the compound's electronic properties, potentially making it useful in electronic or photonic applications. Additionally, 3-Bromo-4-fluorophenylacetylene may be utilized in medicinal chemistry for the development of pharmaceuticals, as halogenated compounds often exhibit unique biological activities. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C8H4BrF
InChI:InChI=1S/C8H4BrF/c1-2-6-3-4-8(10)7(9)5-6/h1,3-5H
InChI key:KJBQVKKHGKJMBQ-UHFFFAOYSA-N
SMILES:C#CC1=CC(=C(C=C1)F)Br
Synonyms:
  • 3-Bromo-4-fluorophenylacetylene
  • Benzene, 2-bromo-4-ethynyl-1-fluoro-
  • 2-bromo-4-ethynyl-1-fluorobenzene
Found 4 products.