CymitQuimica logo

CAS 918488-42-3

:

5-Bromo-6-isoquinolinol

Description:
5-Bromo-6-isoquinolinol is a chemical compound characterized by its isoquinoline structure, which is a bicyclic aromatic compound containing a nitrogen atom in the ring. The presence of a bromine atom at the 5-position and a hydroxyl group at the 6-position contributes to its unique reactivity and properties. This compound typically appears as a solid and is soluble in organic solvents, reflecting its aromatic nature. It may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The bromine substituent can enhance its reactivity in electrophilic aromatic substitution reactions, while the hydroxyl group can participate in hydrogen bonding, influencing its solubility and interaction with biological targets. Additionally, 5-Bromo-6-isoquinolinol may serve as a precursor or intermediate in the synthesis of more complex organic molecules. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C9H6BrNO
InChI:InChI=1S/C9H6BrNO/c10-9-7-3-4-11-5-6(7)1-2-8(9)12/h1-5,12H
InChI key:InChIKey=UAKCWZYJYLLDBJ-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC1O)C=NC=C2
Synonyms:
  • 5-Bromo-6-isoquinolinol
  • 6-Isoquinolinol, 5-bromo-
Found 2 products.