CymitQuimica logo

CAS 918789-44-3

:

2H-1,4-Benzoxazine-6-carboxylic acid, 3,4-dihydro-

Description:
2H-1,4-Benzoxazine-6-carboxylic acid, 3,4-dihydro- is a chemical compound characterized by its unique bicyclic structure, which includes a benzene ring fused to a heterocyclic oxazine ring. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and potential reactivity due to the presence of functional groups. The carboxylic acid group contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Additionally, the dihydro configuration indicates the presence of saturated carbon atoms, which may influence its physical properties, such as solubility and boiling point. This compound may also exhibit biological activity, making it of interest in medicinal chemistry and materials science. Its specific applications and reactivity can vary based on the presence of substituents and the overall molecular environment. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.
Formula:C9H9NO3
InChI:InChI=1S/C9H9NO3/c11-9(12)6-1-2-8-7(5-6)10-3-4-13-8/h1-2,5,10H,3-4H2,(H,11,12)
InChI key:DEDBZPKNGZROQL-UHFFFAOYSA-N
SMILES:C1COC2=C(N1)C=C(C=C2)C(=O)O
Found 5 products.