CAS 918793-04-1
:1H-Carbazole-6-carbonitrile, 3-amino-2,3,4,9-tetrahydro-, (3R)-
Description:
1H-Carbazole-6-carbonitrile, 3-amino-2,3,4,9-tetrahydro-, (3R)-, with CAS number 918793-04-1, is a chemical compound characterized by its complex bicyclic structure, which includes a carbazole moiety and a carbonitrile functional group. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and an amino group that contributes to its reactivity and potential biological activity. The (3R) designation refers to the specific stereochemistry at the chiral center, which can influence the compound's interaction with biological targets. Typically, compounds of this nature may exhibit properties such as fluorescence, making them of interest in materials science and medicinal chemistry. Additionally, the presence of both the amino and carbonitrile groups suggests potential for further chemical modifications, which could enhance its pharmacological properties or utility in synthetic applications. Overall, this compound represents a unique structure with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C13H13N3
InChI:InChI=1S/C13H13N3/c14-7-8-1-3-12-10(5-8)11-6-9(15)2-4-13(11)16-12/h1,3,5,9,16H,2,4,6,15H2/t9-/m1/s1
InChI key:DDLAOJUFZYVVOR-SECBINFHSA-N
SMILES:C1CC2=C(C[C@@H]1N)C3=C(N2)C=CC(=C3)C#N
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
