CAS 918903-20-5
:1,1'-{[2-(2-methoxyphenoxy)ethyl]imino}bis[3-(9H-carbazol-4-yloxy)propan-2-ol]
Description:
The chemical substance known as 1,1'-{[2-(2-methoxyphenoxy)ethyl]imino}bis[3-(9H-carbazol-4-yloxy)propan-2-ol] is a complex organic compound characterized by its unique structural features. It contains multiple functional groups, including an imino group and ether linkages, which contribute to its potential reactivity and solubility properties. The presence of carbazole moieties suggests that this compound may exhibit interesting electronic properties, making it a candidate for applications in organic electronics or photonics. Additionally, the methoxyphenoxy group may enhance its solubility in organic solvents, which is beneficial for various chemical applications. The compound's molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties such as melting point, boiling point, and solubility. Overall, this substance's intricate design and functional groups position it as a potentially valuable material in advanced chemical research and applications.
Formula:C39H39N3O6
InChI:InChI=1/C39H39N3O6/c1-45-34-16-6-7-17-35(34)46-21-20-42(22-26(43)24-47-36-18-8-14-32-38(36)28-10-2-4-12-30(28)40-32)23-27(44)25-48-37-19-9-15-33-39(37)29-11-3-5-13-31(29)41-33/h2-19,26-27,40-41,43-44H,20-25H2,1H3
SMILES:COc1ccccc1OCCN(CC(COc1cccc2c1c1ccccc1[nH]2)O)CC(COc1cccc2c1c1ccccc1[nH]2)O
Synonyms:- Tcmdc-141980
- Carvedilol EP Impurity B/ Carvedilol Related Compound B
- Carvedilol EP IMpurity B
- Carvedilol Related Compound B (USP)
- Carvedilol EP Imp B
- Carvedilol EP Impurity B Q: What is the storage condition of
- Carvedilol EP Impurity BQ: What is
- Carvedilol Impurity 2(Carvedilol EP Impurity B)
- Carvedilol Related Compound B
- Carvedilol IMpurity-B(EP)
- 2-Propanol, 1,1'-[[2-(2-methoxyphenoxy)ethyl]imino]bis[3-(9H-carbazol-4-yloxy)-
- Carvedilol Related Compound B (3,3''-(2-(2-methoxyphenoxy)ethylazanediyl)bis(1-(9H-carbazol-4-yloxy) (1096644)
- Carvedilol EP Impurity B(USP RC B)
- Carvedilol EP Impurity B
- Carvedilol EP Impurity B Q: What are the applications of
- Carvedilol USP Related Compound B
- 1-(9H-carbazol-4-yloxy)-3-[[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl]-[2-(2-methoxyphenoxy)ethyl]amino]propan-2-ol
- Carvedilol impurity B (PhEur)
- Carvedilol Bis-carbazole
- Carvedilol EP Impurity B Q: What is the CAS Number of
- 1,1'-[[2-(2-Methoxyphenoxy)ethyl]imino]bis[3-(9H-carbazol-4-yloxy)-2-propanol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Carvedilol Related Compound B (3,3'-(2-(2-methoxyphenoxy)ethylazanediyl)bis(1-(9H-carbazol-4-yloxy)propan-2-ol))
CAS:Aromatic or modified aromatic heterocyclic compounds withnitrogen hetero-atom(s) only nesoiFormula:C39H39N3O6Color and Shape:Off-White PowderMolecular weight:645.283891-(9H-carbazol-4-yloxy)-3-{[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl][2-(2-methoxyphenoxy)ethyl]amino}propan-2-ol
CAS:1-(9H-carbazol-4-yloxy)-3-{[3-(9H-carbazol-4-yloxy)-2-hydroxypropyl][2-(2-methoxyphenoxy)ethyl]amino}propan-2-olFormula:C39H39N3O6Purity:95%Molecular weight:645.74Carvedilol EP Impurity B (Carvedilol USP Related Compound B) (Mixture of Diastereomers)
CAS:Formula:C39H39N3O6Color and Shape:White To Off-White SolidMolecular weight:645.761,1'-[[2-(2-Methoxyphenoxy)ethyl]nitrilo]bis[3-(9H-carbazol-4-yloxy)propan-2-ol]
CAS:Color and Shape:NeatCarvedilol Bis-carbazole
CAS:Controlled ProductImpurity Carvedilol EP Impurity B; Carvedilol Impurity B; Carvedilol USP B
Applications Carvedilol Bis-carbazole (Carvedilol EP Impurity B; Carvedilol Impurity B; Carvedilol USP B) is an impurity from the process of Carvedilol (C184625).Formula:C39H39N3O6Color and Shape:NeatMolecular weight:645.74







