CAS 91891-24-6

1-(3-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid

Description:

1-(3-Hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid, with the CAS number 91891-24-6, is a chemical compound characterized by its unique pyrrolidine structure, which includes a carboxylic acid functional group and a hydroxyl-substituted phenyl group. This compound typically exhibits properties associated with both its aromatic and aliphatic components, such as potential solubility in polar solvents due to the presence of the hydroxyl and carboxylic acid groups. The oxopyrrolidine moiety suggests that it may participate in various chemical reactions, including those typical of carbonyl compounds. Its structural features may also confer biological activity, making it of interest in medicinal chemistry and pharmacology. The compound's stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species. Overall, 1-(3-hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid represents a versatile structure with implications in both synthetic and biological chemistry.

Formula: C₁₁H₁₁NO₄

InChI: InChI=1/C11H11NO4/c13-9-3-1-2-8(5-9)12-6-7(11(15)16)4-10(12)14/h1-3,5,7,13H,4,6H2,(H,15,16)

InChI key: SSCXSGYHQKJLBC-UHFFFAOYSA-N

SMILES: c1cc(cc(c1)O)N1CC(CC1=O)C(=O)O

Synonyms:

• 3-Pyrrolidinecarboxylic acid, 1-(3-hydroxyphenyl)-5-oxo-
• 1-(3-Hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid

1-(3-Hydroxyphenyl)-5-oxopyrrolidine-3-carboxylic acid

CAS: 91891-24-6

Formula: C₁₁H₁₁NO₄

Molecular weight: 221.2093

Ref: IN-DA00GSS8