CymitQuimica logo

CAS 919095-46-8

:

1,3-Propanedione, 1-(2-furanyl)-3-(2-pyridinyl)-

Description:
1,3-Propanedione, 1-(2-furanyl)-3-(2-pyridinyl)-, also known by its CAS number 919095-46-8, is an organic compound characterized by the presence of a 1,3-diketone functional group, specifically a propanedione structure substituted with a furan ring and a pyridine ring. This compound typically exhibits a yellowish to brown color and is soluble in organic solvents due to its polar functional groups. The furan and pyridine moieties contribute to its aromatic properties, which can influence its reactivity and interactions with other chemical species. The presence of the diketone functionality allows for potential tautomerism and reactivity in various chemical reactions, including condensation and oxidation processes. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and material science. Overall, the unique structural features of 1,3-propanedione derivatives like this one can lead to diverse applications in pharmaceuticals, agrochemicals, and organic synthesis.
Formula:C12H9NO3
InChI:InChI=1S/C12H9NO3/c14-10(9-4-1-2-6-13-9)8-11(15)12-5-3-7-16-12/h1-7H,8H2
InChI key:UOPXXVAHYNKLAA-UHFFFAOYSA-N
SMILES:C1=CC=NC(=C1)C(=O)CC(=O)C2=CC=CO2
Found 1 products.