CymitQuimica logo

CAS 919119-72-5

:

1H-Indole, 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
1H-Indole, 2,7-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, identified by CAS number 919119-72-5, is a complex organic compound featuring an indole core substituted with two boron-containing groups. The presence of the indole structure suggests potential biological activity, as indoles are known for their occurrence in various natural products and pharmaceuticals. The dioxaborolane moieties contribute to the compound's reactivity, particularly in cross-coupling reactions, making it useful in synthetic organic chemistry. The tetramethyl groups enhance the stability and solubility of the compound, which can be advantageous in various applications. Additionally, the compound's unique structure may impart specific electronic properties, influencing its behavior in chemical reactions. Overall, this compound exemplifies the intersection of organic synthesis and medicinal chemistry, with potential applications in drug development and material science.
Formula:C20H29B2NO4
InChI:InChI=1S/C20H29B2NO4/c1-17(2)18(3,4)25-21(24-17)14-11-9-10-13-12-15(23-16(13)14)22-26-19(5,6)20(7,8)27-22/h9-12,23H,1-8H3
InChI key:PVELYJHNTSSSOF-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C3C(=CC=C2)C=C(N3)B4OC(C(O4)(C)C)(C)C
Found 4 products.