CymitQuimica logo

CAS 91912-46-8

:

(5-oxotetrahydrofuran-2-yl)acetyl hydrogen carbonate

Description:
(5-Oxotetrahydrofuran-2-yl)acetyl hydrogen carbonate, with the CAS number 91912-46-8, is a chemical compound characterized by its unique structure that includes a tetrahydrofuran ring and an acetyl group. This compound features a carbonyl group (C=O) at the 5-position of the tetrahydrofuran, contributing to its reactivity and potential applications in organic synthesis. The presence of the hydrogen carbonate moiety suggests that it can act as a source of bicarbonate ions, which may influence its behavior in various chemical reactions, particularly in acid-base chemistry. The compound is likely to be soluble in polar solvents due to the presence of functional groups that can engage in hydrogen bonding. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, this compound may find applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis, although specific applications would depend on further research into its properties and reactivity.
Formula:C7H8O6
InChI:InChI=1/C7H8O6/c8-5-2-1-4(12-5)3-6(9)13-7(10)11/h4H,1-3H2,(H,10,11)
InChI key:ZLAAIVBHMNPPEF-UHFFFAOYSA-N
SMILES:C1CC(=O)OC1CC(=O)OC(=O)O
Found 3 products.