CymitQuimica logo

CAS 91913-76-7

:

1-methoxy-1H-indole-3-carboxylic acid

Description:
1-Methoxy-1H-indole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a methoxy group (-OCH3) and a carboxylic acid group (-COOH) attached to the indole framework, contributing to its chemical reactivity and potential biological activity. The presence of the methoxy group can influence the compound's solubility and polarity, while the carboxylic acid group can participate in acid-base reactions and hydrogen bonding. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for potential interactions with biological targets, which could be explored in research related to therapeutic applications. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and industrial settings.
Formula:C10H9NO3
InChI:InChI=1/C10H9NO3/c1-14-11-6-8(10(12)13)7-4-2-3-5-9(7)11/h2-6H,1H3,(H,12,13)
InChI key:NYXZLEZAQMDQPX-UHFFFAOYSA-N
SMILES:COn1cc(c2ccccc12)C(=O)O
Found 3 products.