CymitQuimica logo

CAS 91926-90-8

:

ethyl-(S)-(Z)-4,5-O-isopropylidene 4,5-dihydroxypent-2-enoate

Description:
Ethyl-(S)-(Z)-4,5-O-isopropylidene 4,5-dihydroxypent-2-enoate, with the CAS number 91926-90-8, is a chemical compound characterized by its specific stereochemistry and functional groups. This compound features an ethyl ester functional group, which contributes to its solubility in organic solvents and potential reactivity in esterification and hydrolysis reactions. The presence of the isopropylidene group indicates that it has a protective acetal structure, which can influence its stability and reactivity under various conditions. The dihydroxypent-2-enoate moiety suggests that it has multiple hydroxyl groups, making it a candidate for hydrogen bonding and increasing its polarity. The (S) configuration denotes a specific stereochemical arrangement, which can affect the compound's biological activity and interactions with other molecules. Overall, this compound's unique structure may make it of interest in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals, where stereochemistry plays a crucial role in efficacy and safety.
Formula:C10H16O4
InChI:InChI=1/C10H16O4/c1-4-12-9(11)6-5-8-7-13-10(2,3)14-8/h5-6,8H,4,7H2,1-3H3/b6-5-/t8-/m0/s1
InChI key:GZVXALXOWVXZLH-SLGIHZDVSA-N
SMILES:CCOC(=O)/C=C\[C@H]1COC(C)(C)O1
Synonyms:
  • ethyl (S)-cis-4,5-O-isopropyl.-4,5-di-hydroxy-2-pentenoate
  • Ethyl (S)-cis-3-(2,2-dimethyl-1,3-dioxolan-4-yl)propenoate
  • ethyl (2Z)-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]prop-2-enoate
Found 3 products.