CymitQuimica logo

CAS 919278-50-5

:

Benzenamine, 3-(2,2,2-trifluoro-1-methoxyethyl)-

Description:
Benzenamine, 3-(2,2,2-trifluoro-1-methoxyethyl)-, also known by its CAS number 919278-50-5, is an organic compound characterized by the presence of a benzene ring substituted with an amine group and a trifluoroalkyl ether moiety. This compound features a trifluoromethyl group, which imparts unique electronic and steric properties, enhancing its lipophilicity and potentially influencing its reactivity and biological activity. The methoxyethyl group contributes to its solubility in organic solvents and may affect its interaction with biological systems. The presence of fluorine atoms typically enhances the stability and metabolic resistance of the compound, making it of interest in pharmaceutical and agrochemical applications. Additionally, the amine functionality can participate in hydrogen bonding, influencing its physical properties such as boiling point and solubility. Overall, this compound's distinctive structure suggests potential utility in various chemical and biological contexts, warranting further investigation into its properties and applications.
Formula:C9H10F3NO
InChI:InChI=1S/C9H10F3NO/c1-14-8(9(10,11)12)6-3-2-4-7(13)5-6/h2-5,8H,13H2,1H3
InChI key:MDTSXKRJXZROCS-UHFFFAOYSA-N
SMILES:COC(C1=CC(=CC=C1)N)C(F)(F)F
Found 1 products.