CymitQuimica logo

CAS 919286-65-0

:

3-Morpholinone, 6-(hydroxymethyl)-, (6R)-

Description:
3-Morpholinone, 6-(hydroxymethyl)-, (6R)- is a chemical compound characterized by its morpholinone structure, which includes a morpholine ring and a hydroxymethyl group at the 6-position. This compound is typically classified as a heterocyclic organic compound due to the presence of nitrogen in the ring. The (6R) designation indicates a specific stereochemistry at the chiral center, which can influence its biological activity and interactions. Morpholinones are often studied for their potential pharmaceutical applications, including antimicrobial and anti-inflammatory properties. The presence of the hydroxymethyl group may enhance solubility and reactivity, making it a valuable intermediate in organic synthesis. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information. Overall, 3-Morpholinone, 6-(hydroxymethyl)-, (6R)- represents a significant compound in medicinal chemistry and organic synthesis.
Formula:C5H9NO3
InChI:InChI=1S/C5H9NO3/c7-2-4-1-6-5(8)3-9-4/h4,7H,1-3H2,(H,6,8)/t4-/m1/s1
InChI key:DMELBDGPDOJCTC-SCSAIBSYSA-N
SMILES:C1[C@@H](OCC(=O)N1)CO
Found 4 products.