CymitQuimica logo

CAS 919360-45-5

:

Benzenesulfonamide, 2-fluoro-4-hydroxy-

Description:
Benzenesulfonamide, 2-fluoro-4-hydroxy- is an organic compound characterized by the presence of a sulfonamide group attached to a benzene ring, which is further substituted with a fluorine atom and a hydroxyl group. This compound typically exhibits properties associated with both aromatic compounds and sulfonamides, including potential solubility in polar solvents due to the hydroxyl group. The fluorine substitution can influence its reactivity and biological activity, often enhancing lipophilicity and altering the compound's interaction with biological targets. The presence of the hydroxyl group may also contribute to hydrogen bonding capabilities, affecting its physical properties such as melting point and boiling point. Benzenesulfonamides are known for their applications in pharmaceuticals, particularly as antibacterial agents, and the specific substitutions in this compound may impart unique pharmacological properties. As with many sulfonamides, it may also exhibit sulfa drug characteristics, which can be relevant in medicinal chemistry and drug design.
Formula:C6H6FNO3S
InChI:InChI=1S/C6H6FNO3S/c7-5-3-4(9)1-2-6(5)12(8,10)11/h1-3,9H,(H2,8,10,11)
InChI key:IIQUOTJAZIMLKX-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1O)F)S(=O)(=O)N
Found 1 products.