CymitQuimica logo

CAS 91958-71-3

:

2-Propenoic acid, 3-(4,5-dimethoxy-2-nitrophenyl)-, ethyl ester

Description:
2-Propenoic acid, 3-(4,5-dimethoxy-2-nitrophenyl)-, ethyl ester, commonly known by its CAS number 91958-71-3, is an organic compound characterized by its structure, which includes a propenoic acid backbone with an ethyl ester functional group and a substituted aromatic ring. This compound typically exhibits properties associated with both esters and nitro-substituted aromatic compounds, such as moderate solubility in organic solvents and potential reactivity in various chemical reactions, including polymerization and electrophilic substitution. The presence of the nitro and methoxy groups on the aromatic ring can influence its electronic properties, making it a candidate for applications in organic synthesis and materials science. Additionally, the compound may display biological activity, which could be of interest in pharmaceutical research. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C13H15NO6
InChI:InChI=1S/C13H15NO6/c1-4-20-13(15)6-5-9-7-11(18-2)12(19-3)8-10(9)14(16)17/h5-8H,4H2,1-3H3/b6-5+
InChI key:RUMVOJBZQRSJMS-AATRIKPKSA-N
SMILES:CCOC(=O)/C=C/C1=CC(=C(C=C1[N+](=O)[O-])OC)OC
Found 1 products.