CymitQuimica logo

CAS 91963-11-0

:

7-hydroxy-3,4,8-trimethylcoumarin

Description:
7-Hydroxy-3,4,8-trimethylcoumarin, with the CAS number 91963-11-0, is a synthetic derivative of coumarin, a class of compounds known for their aromatic properties. This substance features a coumarin backbone with three methyl groups at the 3, 4, and 8 positions, and a hydroxyl group at the 7 position, contributing to its unique chemical characteristics. It typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents, while being less soluble in water. The presence of the hydroxyl group enhances its potential for hydrogen bonding, influencing its reactivity and interactions with other molecules. 7-Hydroxy-3,4,8-trimethylcoumarin is often studied for its potential biological activities, including antioxidant and anti-inflammatory properties, making it of interest in pharmacological research. Additionally, its structural features may allow it to act as a fluorescent probe in various applications. As with many coumarin derivatives, it is important to handle this compound with care, considering potential toxicity and environmental impact.
Formula:C12H12O3
InChI:InChI=1/C12H12O3/c1-6-7(2)12(14)15-11-8(3)10(13)5-4-9(6)11/h4-5,13H,1-3H3
InChI key:GNBLUSRSAGXTJN-UHFFFAOYSA-N
SMILES:Cc1c(C)c(=O)oc2c(C)c(ccc12)O
Synonyms:
  • 7-hydroxy-3,4,8-trimethyl-2H-chromen-2-one
Found 3 products.