CymitQuimica logo

CAS 91981-59-8

:

[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanaminium

Description:
[1,2,4]triazolo[4,3-a]pyridin-3-ylmethanaminium, with CAS number 91981-59-8, is a chemical compound characterized by its unique bicyclic structure that incorporates both triazole and pyridine rings. This compound typically exhibits properties such as being a solid at room temperature, with potential solubility in polar solvents due to the presence of the aminium group. It may display basicity owing to the nitrogen atoms in its structure, which can participate in protonation. The compound is of interest in medicinal chemistry, potentially serving as a scaffold for the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its reactivity can be influenced by the functional groups present, making it suitable for various chemical transformations. Additionally, the presence of heteroatoms in the rings contributes to its electronic properties, which can affect its interaction with biological targets. Overall, [1,2,4]triazolo[4,3-a]pyridin-3-ylmethanaminium represents a versatile compound with potential applications in drug discovery and development.
Formula:C7H9N4
InChI:InChI=1/C7H8N4/c8-5-7-10-9-6-3-1-2-4-11(6)7/h1-4H,5,8H2/p+1
InChI key:NXNFOXNYOMPDMW-UHFFFAOYSA-N
SMILES:C1=CC2=NN=C(N2C=C1)CN
Synonyms:
  • 1-([1,2,4]Triazolo[4,3-A]Pyridin-3-Yl)Methanamine
  • 1,2,4-Triazolo[4,3-A]Pyridine-3-Methanamine
  • [1,2,4]Triazolo[4,3-A]Pyridin-3-Ylmethanamine
Found 5 products.