CymitQuimica logo

CAS 91987-74-5

:

1,4,7,10-tetraazacyclododecane-tetrayl-tetrak.(me.phosph.ac)

Description:
1,4,7,10-Tetraazacyclododecane-tetrayl-tetrakis(methylphosphonate) is a complex chemical compound characterized by its unique structure, which includes a cyclic framework of twelve atoms featuring four nitrogen atoms and four methylphosphonate groups. This compound belongs to the class of polyazamacrocycles, which are known for their ability to form stable complexes with metal ions, making them of interest in coordination chemistry and potential applications in catalysis and materials science. The presence of methylphosphonate groups introduces phosphorus into the structure, which can enhance its reactivity and solubility in various solvents. Additionally, the compound's tetrakis substitution indicates that there are four identical substituents attached to the central framework, which can influence its overall chemical behavior and interactions. The CAS number 91987-74-5 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, this compound's structural features contribute to its potential utility in various fields, including medicinal chemistry and environmental science.
Formula:C12H32N4O12P4
InChI:InChI=1/C12H32N4O12P4/c17-29(18,19)9-13-1-2-14(10-30(20,21)22)5-6-16(12-32(26,27)28)8-7-15(4-3-13)11-31(23,24)25/h1-12H2,(H2,17,18,19)(H2,20,21,22)(H2,23,24,25)(H2,26,27,28)
InChI key:RCXMQNIDOFXYDO-UHFFFAOYSA-N
SMILES:C1CN(CCN(CCN(CCN1CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O)CP(=O)(O)O
Synonyms:
  • 1,4,7,10-Tetraazacyclododecane-1,4,7,10-tetrayl-tetrakis(methylphosphonic acid)
  • (1,4,7,10-Tetraazacyclododecane-1,4,7,10-Tetrayltetramethanediyl)Tetrakis(Phosphonic Acid)
Found 5 products.