CymitQuimica logo

CAS 91990-88-4

:

4-benzoylbenzoic acid N-hydroxy-*succinimide ester

Description:
4-Benzoylbenzoic acid N-hydroxy-succinimide ester, with the CAS number 91990-88-4, is a chemical compound commonly used in organic synthesis and bioconjugation applications. This compound features a benzoyl group attached to a benzoic acid moiety, which is further esterified with N-hydroxysuccinimide (NHS). The NHS group is known for its ability to form stable amide bonds with primary amines, making this compound particularly useful in the development of bioconjugates, such as protein labeling and drug delivery systems. The presence of the benzoyl group contributes to the compound's photochemical properties, allowing it to be utilized in photoinitiated reactions. Additionally, the ester linkage provides a degree of reactivity that can be exploited in various chemical transformations. Overall, 4-benzoylbenzoic acid N-hydroxy-succinimide ester is valued for its versatility in synthetic chemistry and its role in facilitating the conjugation of biomolecules.
Formula:C18H13NO5
InChI:InChI=1/C18H13NO5/c20-15-10-11-16(21)19(15)24-18(23)14-8-6-13(7-9-14)17(22)12-4-2-1-3-5-12/h1-9H,10-11H2
InChI key:MVQNJLJLEGZFGP-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(=O)c1ccc(cc1)C(=O)ON1C(=O)CCC1=O
Synonyms:
  • 4-Benzoylbenzoic acid, succinimidyl ester
  • 1-({[4-(Phenylcarbonyl)Phenyl]Carbonyl}Oxy)Pyrrolidine-2,5-Dione
Found 6 products.