CAS 92-31-9

Toluidine Blue O

Description:

Toluidine Blue O, with the CAS number 92-31-9, is a synthetic dye belonging to the thiazine class of compounds. It is characterized by its deep blue color and is commonly used as a biological stain in histology and cytology due to its ability to bind to nucleic acids and certain proteins. The dye exhibits metachromasia, meaning it can change color when bound to different types of tissues or cellular components, which enhances its utility in microscopy. Toluidine Blue O is soluble in water and alcohol, making it versatile for various applications. In addition to its staining properties, it has been explored for its potential use in photodynamic therapy due to its ability to generate reactive oxygen species upon light activation. Safety considerations include its potential to cause skin and eye irritation, and it is advisable to handle it with appropriate protective measures. Overall, Toluidine Blue O is a valuable tool in both research and clinical settings for visualizing cellular structures.

Formula:C₁₅H₁₆N₃S·Cl

InChI:InChI=1S/C15H16N3S.ClH/c1-9-6-13-15(8-11(9)16)19-14-7-10(18(2)3)4-5-12(14)17-13;/h4-8H,16H2,1-3H3;1H/q+1;/p-1

InChI key:InChIKey=HNONEKILPDHFOL-UHFFFAOYSA-M

SMILES:N(C)(C)C1=CC2=C(N=C3C(=[S+]2)C=C(N)C(C)=C3)C=C1.[Cl-]

Synonyms: