CymitQuimica logo

CAS 920021-67-6

:

Acetic acid, 2-(4-phenylcyclohexylidene)-, methyl ester

Description:
Acetic acid, 2-(4-phenylcyclohexylidene)-, methyl ester, identified by the CAS number 920021-67-6, is an organic compound characterized by its ester functional group. This substance features a cyclohexylidene moiety substituted with a phenyl group, contributing to its unique structural properties. The presence of the acetic acid component indicates that it can participate in various chemical reactions typical of esters, such as hydrolysis and transesterification. The compound is likely to exhibit moderate polarity due to the ester group, influencing its solubility in organic solvents and water. Additionally, the phenylcyclohexylidene structure may impart specific steric and electronic properties, potentially affecting its reactivity and interactions with other molecules. While specific physical properties such as boiling point, melting point, and density are not provided, compounds of this nature typically have moderate volatility and may be used in various applications, including organic synthesis and as intermediates in the production of pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage guidelines.
Formula:C15H18O2
InChI:InChI=1S/C15H18O2/c1-17-15(16)11-12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-6,11,14H,7-10H2,1H3
InChI key:XHTQDIAKNSUYJB-UHFFFAOYSA-N
SMILES:COC(=O)C=C1CCC(CC1)C2=CC=CC=C2
Found 1 products.