CymitQuimica logo

CAS 92026-64-7

:

2-chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)acetamide

Description:
2-Chloro-N-(3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl)acetamide is a chemical compound characterized by its unique structure, which includes a chloro group and a pyrazole moiety. This compound features a chloro substituent on the acetamide group, which can influence its reactivity and biological activity. The presence of the 3,5-dimethyl-1-phenyl-1H-pyrazol-4-yl group contributes to its potential pharmacological properties, as pyrazole derivatives are often investigated for their anti-inflammatory, analgesic, and antipyretic effects. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the presence of the chloro group may enhance lipophilicity, affecting its absorption and distribution in biological systems. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards.
Formula:C13H14ClN3O
InChI:InChI=1/C13H14ClN3O/c1-9-13(15-12(18)8-14)10(2)17(16-9)11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,15,18)
InChI key:NZZOTUMBWBHBJT-UHFFFAOYSA-N
SMILES:Cc1c(c(C)n(c2ccccc2)n1)N=C(CCl)O
Found 1 products.