CymitQuimica logo

CAS 92028-39-2

:

2-(benzyloxy)-5-methylpyridine

Description:
2-(Benzyloxy)-5-methylpyridine, with the CAS number 92028-39-2, is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a benzyloxy group, which is a benzene ring attached to an oxygen atom, and a methyl group at the 5-position of the pyridine ring. The presence of these functional groups contributes to its chemical properties, including its solubility in organic solvents and potential reactivity in various chemical reactions. The compound may exhibit moderate polarity due to the combination of the aromatic and heteroatom-containing structures. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Additionally, its structural features suggest potential applications in medicinal chemistry, where modifications to the pyridine ring can influence biological activity. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C13H13NO
InChI:InChI=1S/C13H13NO/c1-11-7-8-13(14-9-11)15-10-12-5-3-2-4-6-12/h2-9H,10H2,1H3
InChI key:WSNVIUZAXLTSLK-UHFFFAOYSA-N
SMILES:CC1=CN=C(C=C1)OCC2=CC=CC=C2
Found 2 products.