CymitQuimica logo

CAS 92033-76-6

:

Piperidine, 1-[2-(4-nitrophenoxy)ethyl]-

Description:
Piperidine, 1-[2-(4-nitrophenoxy)ethyl]- is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a 4-nitrophenoxy group attached to a 2-ethyl chain, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. The presence of the nitro group enhances its reactivity and may influence its solubility in various solvents. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological systems. Its molecular structure allows for various functionalization, making it a versatile intermediate in organic synthesis. Safety data indicates that, like many nitro compounds, it may pose certain hazards, necessitating careful handling and storage. Overall, Piperidine, 1-[2-(4-nitrophenoxy)ethyl]- is a significant compound in chemical research and development.
Formula:C13H18N2O3
InChI:InChI=1S/C13H18N2O3/c16-15(17)12-4-6-13(7-5-12)18-11-10-14-8-2-1-3-9-14/h4-7H,1-3,8-11H2
InChI key:HLQQRQNEDYOBHS-UHFFFAOYSA-N
SMILES:C1CCN(CC1)CCOC2=CC=C(C=C2)[N+](=O)[O-]
Found 1 products.