CymitQuimica logo

CAS 920501-69-5

:

1-(4-Fluorophenyl)cyclobutanamine

Description:
1-(4-Fluorophenyl)cyclobutanamine is an organic compound characterized by its cyclobutane ring structure substituted with a 4-fluorophenyl group and an amine functional group. The presence of the fluorine atom on the phenyl ring can influence the compound's electronic properties, potentially enhancing its lipophilicity and affecting its biological activity. This compound is typically classified as an aromatic amine due to the amine group attached to a cyclic structure. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the cyclobutane and phenyl groups can lead to variations in pharmacological properties. The compound's solubility, stability, and reactivity can be influenced by the steric and electronic effects of the substituents. Additionally, the presence of the cyclobutane ring may impart unique conformational characteristics, which can be significant in drug design and interaction with biological targets. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H12FN
InChI:InChI=1S/C10H12FN/c11-9-4-2-8(3-5-9)10(12)6-1-7-10/h2-5H,1,6-7,12H2
InChI key:InChIKey=PAPAYUQUJVLXAF-UHFFFAOYSA-N
SMILES:NC1(CCC1)C2=CC=C(F)C=C2
Synonyms:
  • 1-(4-Fluorophenyl)cyclobutan-1-amine
  • Cyclobutanamine, 1-(4-Fluorophenyl)-
  • 1-(4-Fluorophenyl)cyclobutanamine
Found 2 products.