CAS 92052-29-4
:[(2S,3R,4S,5S,6S)-3,4,5-triacetoxy-6-(2,2,2-trichloroethanimidoyl)oxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(2S,3R,4S,5S,6S)-3,4,5-triacetoxy-6-(2,2,2-trichloroethanimidoyl)oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 92052-29-4 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple acetoxy groups, indicating the presence of acetyl functional groups that enhance its reactivity and solubility in organic solvents. The presence of the trichloroethanimidoyl moiety suggests potential biological activity, possibly as a pesticide or herbicide, due to the incorporation of halogenated groups known for their toxicity to certain organisms. The stereochemistry of the molecule, denoted by the (2S,3R,4S,5S,6S) configuration, indicates specific spatial arrangements of atoms that can influence its biological interactions and properties. Overall, this compound's unique structure and functional groups contribute to its potential applications in various fields, including agriculture and pharmaceuticals.
Formula:C16H20Cl3NO10
InChI:InChI=1/C16H20Cl3NO10/c1-6(21)25-5-10-11(26-7(2)22)12(27-8(3)23)13(28-9(4)24)14(29-10)30-15(20)16(17,18)19/h10-14,20H,5H2,1-4H3/t10-,11+,12-,13-,14-/m0/s1
InChI key:IBUZGVQIKARDAF-RGDJUOJXSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2,3,4,6-Tetra-O-acetyl-beta-D-glucopyranosyl 2,2,2-Trichloroacetimidate
CAS:Formula:C16H20Cl3NO10Purity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:492.682,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl 2,2,2-Trichloroacetimidate
CAS:Formula:C16H20Cl3NO10Purity:95%Color and Shape:SolidMolecular weight:492.68972,3,4,6-Tetra-O-acetyl-1-O-trichloroacetimidoyl-β-D-glucopyranoside
CAS:2,3,4,6-Tetra-O-acetyl-1-O-trichloroacetimidoyl-β-D-glucopyranosideFormula:C16H20Cl3NO10Purity:98%Color and Shape:Off-white SolidMolecular weight:492.689692,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl trichloroacetimidate
CAS:Gadolinium is a magnetic, paramagnetic metal that is used to enhance the contrast in magnetic resonance imaging (MRI) and has been shown to be effective in ectopic expression of gene products. Gadolinium-enhanced MRI has been shown to be a more sensitive method for detection of pancreatic cancer cells than CT scans. Gadolinium also binds to monoclonal antibodies and can be detected using immunohistochemical staining. Gadolinium is a prohormone that is converted into its active form by cleavage of the glycosidic bond between carbons 2 and 3 in the 6-phosphate position. The gadolinium ion is chemically neutral, which may account for its lack of toxicity in vivo.Formula:C16H20Cl3NO10Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:492.69 g/mol2,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl trichloroacetimidate
CAS:2,3,4,6-Tetra-O-acetyl-b-D-glucopyranosyl trichloroacetimidateFormula:C16H20Cl3NO10Purity:98%Molecular weight:492.692,3,4,6-Tetra-O-acetyl-β-D-glucopyranosyl trichloroacetimidate, 98%(N)
CAS:Purity:95%Molecular weight:491.02






