CymitQuimica logo

CAS 92059-97-7

:

2-bromo-N-(4-hydroxyphenyl)benzamide

Description:
2-Bromo-N-(4-hydroxyphenyl)benzamide is an organic compound characterized by its structural features, which include a bromine atom and a hydroxyl group attached to a phenyl ring. This compound belongs to the class of amides, where the amine group is substituted with a 4-hydroxyphenyl moiety. The presence of the bromine atom introduces notable reactivity, making it useful in various chemical reactions, including electrophilic aromatic substitution. The hydroxyl group contributes to the compound's potential for hydrogen bonding, influencing its solubility and interaction with biological systems. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure suggests that it may have applications in research related to pharmaceuticals or agrochemicals. Additionally, the compound's properties, such as melting point, boiling point, and solubility, can vary based on the solvent and conditions, which are essential for practical applications in laboratory settings.
Formula:C13H10BrNO2
InChI:InChI=1/C13H10BrNO2/c14-12-4-2-1-3-11(12)13(17)15-9-5-7-10(16)8-6-9/h1-8,16H,(H,15,17)
SMILES:c1ccc(c(c1)C(=O)Nc1ccc(cc1)O)Br
Synonyms:
  • benzamide, 2-bromo-N-(4-hydroxyphenyl)-
  • 2-Bromo-N-(4-hydroxyphenyl)benzamide
Found 1 products.