CymitQuimica logo

CAS 92084-99-6

:

4-PhenylpyriMidine-5-carboxylic acid

Description:
4-Phenylpyrimidine-5-carboxylic acid is an organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of a phenyl group at the 4-position and a carboxylic acid functional group at the 5-position contributes to its chemical properties. This compound typically exhibits moderate solubility in polar solvents due to the carboxylic acid group, which can engage in hydrogen bonding. It may also display acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. The compound is of interest in pharmaceutical and materials science research, potentially serving as a building block for the synthesis of more complex molecules. Its unique structure may also impart specific biological activities, making it a candidate for further investigation in medicinal chemistry. Safety data and handling precautions should be observed, as with any chemical substance, to ensure safe laboratory practices.
Formula:C11H8N2O2
InChI:InChI=1S/C11H8N2O2/c14-11(15)9-6-12-7-13-10(9)8-4-2-1-3-5-8/h1-7H,(H,14,15)
InChI key:PDTTUTBMTVDZKV-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC=NC=C2C(=O)O
Synonyms:
  • 5-Pyrimidinecarboxylic acid, 4-phenyl-
  • 4-PhenylpyriMidine-5-carboxylic acid
Found 4 products.