CymitQuimica logo

CAS 920978-94-5

:

5-fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid

Description:
5-Fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of a fluorine atom at the 5-position of the pyrrole ring contributes to its unique chemical properties, potentially influencing its reactivity and biological activity. The carboxylic acid functional group at the 2-position enhances its polarity and solubility in polar solvents, making it suitable for various applications in medicinal chemistry and drug development. This compound may exhibit interesting pharmacological properties, including potential anti-cancer or anti-inflammatory activities, due to its structural features that allow for interactions with biological targets. Additionally, its molecular structure can facilitate the formation of hydrogen bonds, which is crucial for binding interactions in biological systems. Overall, 5-fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid represents a valuable scaffold for the design of novel therapeutic agents.
Formula:C8H5FN2O2
InChI:InChI=1/C8H5FN2O2/c9-5-1-4-2-6(8(12)13)11-7(4)10-3-5/h1-3H,(H,10,11)(H,12,13)
InChI key:GLNFIUUKQXOTOZ-UHFFFAOYSA-N
SMILES:c1c2cc(C(=O)O)[nH]c2ncc1F
Synonyms:
  • 1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid, 5-fluoro-
  • 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylic acid
Found 4 products.