CymitQuimica logo

CAS 920978-95-6

:

Ethyl5-fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate

Description:
Ethyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate is a chemical compound characterized by its unique pyrrolopyridine structure, which incorporates a fluorine atom at the 5-position of the pyrrole ring. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of the carboxylate moiety enhances its potential for various chemical reactions, including esterification and nucleophilic substitution. The fluorine atom can influence the compound's electronic properties, potentially enhancing its biological activity or altering its interaction with other molecules. Ethyl 5-fluoro-1H-pyrrolo[2,3-b]pyridine-2-carboxylate may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can be tailored for specific biological targets. Its synthesis typically involves multi-step organic reactions, and it may be characterized using techniques such as NMR spectroscopy, mass spectrometry, and chromatography to confirm its purity and structural integrity.
Formula:C10H9FN2O2
InChI:InChI=1S/C10H9FN2O2/c1-2-15-10(14)8-4-6-3-7(11)5-12-9(6)13-8/h3-5H,2H2,1H3,(H,12,13)
InChI key:WWQDGBCPFZOGBI-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=CC(=CN=C2N1)F
Found 1 products.