CymitQuimica logo

CAS 921145-14-4

:

N-Methyl-1-(5-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride

Description:
N-Methyl-1-(5-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride is a chemical compound characterized by its unique thiazole ring structure, which contributes to its biological activity. This compound features a methyl group attached to a nitrogen atom, enhancing its lipophilicity and potentially influencing its pharmacokinetic properties. The presence of the dihydrochloride salt form indicates that it is a hydrochloride salt, which typically improves solubility in aqueous solutions, making it suitable for various applications in pharmaceutical formulations. The thiazole moiety is known for its role in various biological activities, including antimicrobial and antifungal properties. As a dihydrochloride, it is likely to be a stable, crystalline solid at room temperature, with a specific melting point and solubility profile that can be influenced by the presence of the hydrochloride groups. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C6H10N2S
InChI:InChI=1S/C6H10N2S/c1-5-3-8-6(9-5)4-7-2/h3,7H,4H2,1-2H3
InChI key:SMMNSOCRUQVCIP-UHFFFAOYSA-N
SMILES:CC1=CN=C(S1)CNC
Synonyms:
  • N-methyl-1-(5-methyl-1,3-thiazol-2-yl)methanamine
  • N-Methyl-1-(5-methyl-1,3-thiazol-2-yl)methanamine dihydrochloride
  • 2-Thiazolemethanamine, N,5-dimethyl-
  • N,5-dimethyl-2-Thiazolemethanamine
  • N-methyl(5-methylthiazol-2-yl)methanamine
  • N-methyl-1-(5-methylthiazol-2-yl)methanamine
Found 4 products.