CymitQuimica logo

CAS 92119-00-1

:

4'-ETHYL-BIPHENYL-4-CARBONYL CHLORIDE

Description:
4'-Ethyl-biphenyl-4-carbonyl chloride, with the CAS number 92119-00-1, is an organic compound characterized by its biphenyl structure substituted with an ethyl group and a carbonyl chloride functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can participate in nucleophilic acyl substitution reactions. This makes it useful in organic synthesis, particularly in the preparation of various derivatives and intermediates in pharmaceuticals and agrochemicals. The compound is likely to be soluble in organic solvents such as dichloromethane and ether, while being less soluble in water due to its hydrophobic biphenyl structure. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be corrosive and may release harmful gases upon hydrolysis. Proper storage in a cool, dry place, away from moisture and incompatible materials, is essential to maintain its stability and integrity.
Formula:C15H13ClO
InChI:InChI=1S/C15H13ClO/c1-2-11-3-5-12(6-4-11)13-7-9-14(10-8-13)15(16)17/h3-10H,2H2,1H3
InChI key:KCQXJABRHPKBDC-UHFFFAOYSA-N
SMILES:CCC1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)Cl
Found 1 products.