CymitQuimica logo

CAS 921205-02-9

:

1,3,5-Tri(p-pyrid-3-ylphenyl)benzene

Description:
1,3,5-Tri(p-pyrid-3-ylphenyl)benzene is an organic compound characterized by its complex molecular structure, which features a central benzene ring substituted at the 1, 3, and 5 positions with three p-pyrid-3-ylphenyl groups. This compound exhibits properties typical of aromatic compounds, including stability and a tendency to participate in π-π stacking interactions due to its extended conjugated system. The presence of pyridine rings introduces nitrogen atoms into the structure, which can influence its electronic properties and reactivity, potentially allowing for coordination with metal ions or participation in hydrogen bonding. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics, such as organic light-emitting diodes (OLEDs) or organic photovoltaics. Its solubility and stability in various solvents can vary, depending on the specific substituents and their interactions. Overall, 1,3,5-Tri(p-pyrid-3-ylphenyl)benzene is a notable compound in the field of organic chemistry and materials science.
Formula:C39H27N3
InChI:InChI=1S/C39H27N3/c1-4-34(25-40-19-1)28-7-13-31(14-8-28)37-22-38(32-15-9-29(10-16-32)35-5-2-20-41-26-35)24-39(23-37)33-17-11-30(12-18-33)36-6-3-21-42-27-36/h1-27H
InChI key:InChIKey=ACSHDTNTFKFOOH-UHFFFAOYSA-N
SMILES:C1(=CC(=CC(=C1)C2=CC=C(C=C2)C=3C=CC=NC3)C4=CC=C(C=C4)C=5C=CC=NC5)C6=CC=C(C=C6)C=7C=CC=NC7
Synonyms:
  • 1,3,5-Tri(p-pyrid-3-ylphenyl)benzene
  • 1,3,5-Tri(4-pyrid-3-ylphenyl)benzene
  • TpPyPB
  • Pyridine, 3,3′-[5′-[4-(3-pyridinyl)phenyl][1,1′:3′,1′′-terphenyl]-4,4′′-diyl]bis-
  • 3,3′-[5′-[4-(3-Pyridinyl)phenyl][1,1′:3′,1′′-terphenyl]-4,4′′-diyl]bis[pyridine]
Found 4 products.