CymitQuimica logo

CAS 921592-91-8

:

3-Methyl-3-Pyrrolidinol hydrochloride

Description:
3-Methyl-3-pyrrolidinol hydrochloride is a chemical compound characterized by its pyrrolidine structure, which features a five-membered ring containing nitrogen. This compound is typically a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydroxyl group (-OH) contributes to its polar nature, enhancing its solubility. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. This compound may be used in pharmaceutical research and development, particularly in the synthesis of various bioactive molecules. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions. Safety data should be consulted, as with any chemical, to understand its handling, storage, and potential hazards. Overall, 3-Methyl-3-pyrrolidinol hydrochloride is an important compound in organic chemistry and medicinal chemistry contexts.
Formula:C5H12ClNO
InChI:InChI=1S/C5H11NO.ClH/c1-5(7)2-3-6-4-5;/h6-7H,2-4H2,1H3;1H
InChI key:ZDVCDFWGMDLBMU-UHFFFAOYSA-N
SMILES:CC1(CCNC1)O.Cl
Synonyms:
  • 3-Pyrrolidinol, 3-methyl-, hydrochloride (1:1)
  • 3-Methyl-3-pyrrolidinol hydrochloride (1:1)
  • 3-Methyl-3-pyrrolidinol HCl
Found 6 products.