CAS 922150-12-7

N-[2-[[4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl]methyl]-4-quinazolinyl]-L-valine methyl ester

Description:

N-[2-[[4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl]methyl]-4-quinazolinyl]-L-valine methyl ester, with CAS number 922150-12-7, is a synthetic organic compound characterized by its complex structure, which includes a quinazoline moiety, a piperazine ring, and a valine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to its structural components, which may interact with biological targets. The presence of the bis(4-chlorophenyl)methyl group suggests potential lipophilicity, which can influence its pharmacokinetic properties. Additionally, the incorporation of the L-valine methyl ester may enhance its stability and bioavailability. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of medicinal chemistry and drug development, where they may exhibit activity against specific biological pathways or diseases. However, detailed studies on its pharmacological effects, toxicity, and mechanism of action would be necessary to fully understand its potential applications.

Formula: C₃₂H₃₅Cl₂N₅O₂

InChI: InChI=1S/C32H35Cl2N5O2/c1-21(2)29(32(40)41-3)37-31-26-6-4-5-7-27(26)35-28(36-31)20-38-16-18-39(19-17-38)30(22-8-12-24(33)13-9-22)23-10-14-25(34)15-11-23/h4-15,21,29-30H,16-20H2,1-3H3,(H,35,36,37)/t29-/m0/s1

InChI key: InChIKey=DFBRKGUTHGRQMH-LJAQVGFWSA-N

SMILES: C(N1CCN(CC=2N=C(N[C@H](C(OC)=O)C(C)C)C3=C(N2)C=CC=C3)CC1)(C4=CC=C(Cl)C=C4)C5=CC=C(Cl)C=C5

Synonyms:

• N-[2-[[4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl]methyl]-4-quinazolinyl]-L-valine methyl ester
• L-Valine, N-[2-[[4-[bis(4-chlorophenyl)methyl]-1-piperazinyl]methyl]-4-quinazolinyl]-, methyl ester

P53R3

CAS: 922150-12-7

P53R3

Purity: ≥95%

Molecular weight: 592.56g/mol

Ref: 54-BUP09350

P53R3

CAS: 922150-12-7

P53R3 is a potent reactivator of p53, effectively restoring sequence-specific DNA binding to several p53 hot spot mutants, namely p53 R175H, p53 R248W, and p53

Formula: C₃₂H₃₅Cl₂N₅O₂

Purity: 98.8%

Color and Shape: Solid

Molecular weight: 592.56

Ref: TM-T41068