CAS 922500-91-2
:ethyl 2-(oxetan-3-ylidene)acetate
Description:
Ethyl 2-(oxetan-3-ylidene)acetate is an organic compound characterized by its unique structure, which includes an ethyl ester functional group and an oxetane ring. The presence of the oxetane moiety contributes to its potential reactivity and stability, making it of interest in various synthetic applications. This compound typically exhibits moderate polarity due to the ester group, which can influence its solubility in organic solvents. Ethyl 2-(oxetan-3-ylidene)acetate may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, owing to the strained nature of the oxetane ring. Its applications may extend to fields such as medicinal chemistry, materials science, and organic synthesis, where it can serve as an intermediate or building block for more complex molecules. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C7H10O3
InChI:InChI=1/C7H10O3/c1-2-10-7(8)3-6-4-9-5-6/h3H,2,4-5H2,1H3
SMILES:CCOC(=O)C=C1COC1
Synonyms:- Acetic Acid, 2-(3-Oxetanylidene)-, Ethyl Ester
- Ethyl oxetan-3-ylideneacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethyl 2-(Oxetan-3-Ylidene)Acetate
CAS:Formula:C7H10O3Purity:98%Color and Shape:LiquidMolecular weight:142.1525Ethyl 2-(oxetan-3-ylidene)acetate
CAS:Ethyl 2-(oxetan-3-ylidene)acetateFormula:C7H10O3Purity:>98%Color and Shape:LiquidMolecular weight:142.15249Ethyl 2-(oxetan-3-ylidene)acetate
CAS:Formula:C7H10O3Purity:97%Color and Shape:LiquidMolecular weight:142.154Ethyl 2-(oxetan-3-ylidene)acetate
CAS:Ethyl 2-(oxetan-3-ylidene)acetateFormula:C7H10O3Purity:97%Molecular weight:142.15Ethyl 2-(oxetan-3-ylidene)acetate
CAS:Please enquire for more information about Ethyl 2-(oxetan-3-ylidene)acetate including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C7H10O3Purity:Min. 95%Molecular weight:142.15 g/mol




